نمایش نتایج جستجو برای
نویسنده: vahid rezaei yazdan abad
موارد یافت شده: 3
1 - Supramolecular assembly mediated through NH···OX (X = C, N, P) hydrogen bonds and Y···π (Y = Br, π) contacts: Structural/computational studies of the P(O)(NHC(O)C6H4-3-NO2)(NHC6H4-3-Br)2 phosphoric triamide (چکیده)2 - Three new [3-NO2-C6H4C(O)NH]P(O)[NRR']2 (NRR' = N(C2H5)(C6H11), NC4H8O & NC5H9-4-CH3) phosphoric triamide structures (چکیده)
3 - Synthesis, spectroscopic characterizationand crystal structure and of N-(bis-isopropylamino)phosphoryl-3-nitro benzamide (چکیده)
